3-deoxy-D-arabino-heptulosonate-7-phosphate
| Internal ID | 9f6c7604-bfe1-4a6f-bdc3-309dbd358ae8 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Monosaccharides > Monosaccharide phosphates |
| IUPAC Name | (4R,5S,6R)-4,5,6-trihydroxy-2-oxo-7-phosphonooxyheptanoic acid |
| SMILES (Canonical) | C(C(C(C(COP(=O)(O)O)O)O)O)C(=O)C(=O)O |
| SMILES (Isomeric) | C([C@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)O)C(=O)C(=O)O |
| InChI | InChI=1S/C7H13O10P/c8-3(1-4(9)7(12)13)6(11)5(10)2-17-18(14,15)16/h3,5-6,8,10-11H,1-2H2,(H,12,13)(H2,14,15,16)/t3-,5-,6+/m1/s1 |
| InChI Key | PJWIPEXIFFQAQZ-PUFIMZNGSA-N |
| Popularity | 87 references in papers |
| Molecular Formula | C7H13O10P |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.02463360 g/mol |
| Topological Polar Surface Area (TPSA) | 182.00 Ų |
| XlogP | -4.00 |
| 2-Dahp |
| 3-deoxy-D-arabino-heptulosonate-7-phosphate |
| 7-phospho-2-dehydro-3-deoxy-D-arabino-heptonic acid |
| 3-deoxy-7-O-phosphono-D-arabino-hept-2-ulosonic acid |
| 3-deoxy-D-arabino-heptulosonate 7-phosphate |
| 3-Deoxy-D-arabino-heptulosonic acid 7-phosphate |
| 3-Deoxy-arabino-heptulonate 7-phosphate |
| (4R,5S,6R)-4,5,6-trihydroxy-2-oxo-7-phosphonooxyheptanoic acid |
| 3-Deoxy-D-arabino-hept-2-ulosonate 7-phosphate |
| 2-dehydro-3-deoxy-D-arabino-heptonate 7-phosphate |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 95.47% | 97.29% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.12% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.83% | 83.82% |
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 86.61% | 94.01% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.82% | 99.17% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.20% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| PubChem | 160647 |
| LOTUS | LTS0275769 |
| wikiData | Q2690247 |