3-Deacetylsalannin
Internal ID | eac8fb5c-957c-4830-8d64-ef67437522f5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [(1R,2S,4R,6R,9R,10R,11R,12S,14R,15R,18R)-6-(furan-3-yl)-14-hydroxy-10-(2-methoxy-2-oxoethyl)-7,9,11,15-tetramethyl-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-12-yl] (E)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC(C2(COC3C2C1(C(C4(C3OC5C4=C(C(C5)C6=COC=C6)C)C)CC(=O)OC)C)C)O |
SMILES (Isomeric) | C/C=C(\C)/C(=O)O[C@H]1C[C@H]([C@]2(CO[C@@H]3[C@@H]2[C@]1([C@H]([C@]4([C@@H]3O[C@H]5C4=C([C@@H](C5)C6=COC=C6)C)C)CC(=O)OC)C)C)O |
InChI | InChI=1S/C32H42O8/c1-8-16(2)29(35)40-23-13-22(33)30(4)15-38-26-27(30)31(23,5)21(12-24(34)36-7)32(6)25-17(3)19(18-9-10-37-14-18)11-20(25)39-28(26)32/h8-10,14,19-23,26-28,33H,11-13,15H2,1-7H3/b16-8+/t19-,20-,21-,22-,23+,26-,27+,28-,30-,31+,32-/m1/s1 |
InChI Key | MJNRBOGIPLCVIM-LJEOTECVSA-N |
Popularity | 4 references in papers |
Molecular Formula | C32H42O8 |
Molecular Weight | 554.70 g/mol |
Exact Mass | 554.28796829 g/mol |
Topological Polar Surface Area (TPSA) | 104.00 Ų |
XlogP | 3.40 |
3-Deacetylsalannin |
1110-56-1 |
CHEBI:67311 |
DESACETYL SALANNIN |
CHEMBL2270444 |
DTXSID201316747 |
2H,3H-Cyclopenta[d']naphtho[1,8-bc:2,3-b']difuran-6-acetic acid, 8-(3-furanyl)-2a,4,5,5a,6,6a,8,9,9a,10a,10b,10c-dodecahydro-3-hydroxy-2a,5a,6a,7-tetramethyl-5-[[(2E)-2-methyl-1-oxo-2-butenyl]oxy]-, methyl ester, (2aR,3R,5S,5aR,6R,6aR,8R,9aR,10aS,10bR,10cR)- |
HY-N3698 |
BDBM50495949 |
AKOS040761580 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha |
33 nM |
Kd |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.38% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.80% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.78% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.65% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.37% | 94.45% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.63% | 90.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.55% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.11% | 96.00% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 89.36% | 81.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.36% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.85% | 89.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.65% | 95.50% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.88% | 85.14% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 87.01% | 97.53% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 86.84% | 87.67% |
CHEMBL5028 | O14672 | ADAM10 | 86.45% | 97.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.29% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.35% | 92.62% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.01% | 93.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.35% | 94.73% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 84.34% | 89.67% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 82.72% | 89.44% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.31% | 90.24% |
CHEMBL2581 | P07339 | Cathepsin D | 81.73% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.39% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.28% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Azadirachta indica |
Melia azedarach |
PubChem | 14458886 |
LOTUS | LTS0075551 |
wikiData | Q27135767 |