3-(Carboxymethylamino)propanoic acid
| Internal ID | cbe66117-16d0-4ec7-84f9-ee839dc33d86 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acids |
| IUPAC Name | 3-(carboxymethylamino)propanoic acid |
| SMILES (Canonical) | C(CNCC(=O)O)C(=O)O |
| SMILES (Isomeric) | C(CNCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c7-4(8)1-2-6-3-5(9)10/h6H,1-3H2,(H,7,8)(H,9,10) |
| InChI Key | GAUBNQMYYJLWNF-UHFFFAOYSA-N |
| Popularity | 11 references in papers |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05315777 g/mol |
| Topological Polar Surface Area (TPSA) | 86.60 Ų |
| XlogP | -3.40 |
| 505-72-6 |
| N-(2-carboxyethyl)glycine |
| N-(carboxymethyl)--alanine |
| NSC134478 |
| 3-((carboxymethyl)amino)propanoic acid |
| NSC-134478 |
| 3-[(carboxymethyl)amino]propanoic acid |
| N-(Carboxyethyl)glycine |
| Iminopropionicacetic acid |
| NCIStruc1_001622 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.30% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.42% | 99.17% |
| CHEMBL1938211 | O15054 | Lysine-specific demethylase 6B | 87.37% | 83.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.20% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.21% | 98.95% |
| CHEMBL4070 | P19784 | Casein kinase II alpha (prime) | 82.10% | 91.67% |
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 81.23% | 94.01% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vigna radiata var. radiata |
| PubChem | 281622 |
| LOTUS | LTS0075775 |
| wikiData | Q82946767 |