3-Butan-2-yl-4-methyl-2,3-dihydropyrrolo[3,4-b]quinoline-1,6-dione
| Internal ID | 3b76f920-93ca-4d5a-83ca-c8bfa073942a |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Pyrroloquinolines |
| IUPAC Name | 3-butan-2-yl-4-methyl-2,3-dihydropyrrolo[3,4-b]quinoline-1,6-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H18N2O2/c1-4-9(2)14-15-12(16(20)17-14)7-10-5-6-11(19)8-13(10)18(15)3/h5-9,14H,4H2,1-3H3,(H,17,20) |
| InChI Key | GTNBOKIWQUJZFH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.136827821 g/mol |
| Topological Polar Surface Area (TPSA) | 49.40 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
![2D Structure of 3-Butan-2-yl-4-methyl-2,3-dihydropyrrolo[3,4-b]quinoline-1,6-dione](https://plantaedb.com/storage/docs/compounds/2023/11/3-butan-2-yl-4-methyl-23-dihydropyrrolo34-bquinoline-16-dione.jpg "2D Structure of 3-Butan-2-yl-4-methyl-2,3-dihydropyrrolo[3,4-b]quinoline-1,6-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.27% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.72% | 96.09% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.59% | 98.59% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.66% | 83.82% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 88.98% | 89.92% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.33% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.49% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.40% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.57% | 94.75% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.00% | 93.40% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.56% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.86% | 94.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.09% | 97.25% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.42% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85107602 |
| LOTUS | LTS0064448 |
| wikiData | Q104167469 |