[3-Bromo-1-[5-(1-bromoprop-2-ynyl)-3-hydroxyoxolan-2-yl]oct-5-en-2-yl] acetate
| Internal ID | d0d502b7-63c7-4999-92ad-59b4935b958f |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > C-glycosyl compounds |
| IUPAC Name | [3-bromo-1-[5-(1-bromoprop-2-ynyl)-3-hydroxyoxolan-2-yl]oct-5-en-2-yl] acetate |
| SMILES (Canonical) | CCC=CCC(C(CC1C(CC(O1)C(C#C)Br)O)OC(=O)C)Br |
| SMILES (Isomeric) | CCC=CCC(C(CC1C(CC(O1)C(C#C)Br)O)OC(=O)C)Br |
| InChI | InChI=1S/C17H24Br2O4/c1-4-6-7-8-13(19)16(22-11(3)20)10-17-14(21)9-15(23-17)12(18)5-2/h2,6-7,12-17,21H,4,8-10H2,1,3H3 |
| InChI Key | AHJKPRCXDUDCBX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H24Br2O4 |
| Molecular Weight | 452.20 g/mol |
| Exact Mass | 452.00209 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.41% | 96.09% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.26% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.20% | 91.11% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.97% | 96.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.17% | 97.21% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.22% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.94% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.84% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.66% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.38% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.44% | 91.19% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 85.07% | 95.93% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.38% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.11% | 89.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.61% | 89.50% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.08% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162899238 |
| LOTUS | LTS0090990 |
| wikiData | Q104912273 |