3-benzo-1,3-dioxol-5-ylpropionic Acid Piperidide
| Internal ID | 31cb85b6-5d33-46ee-a7c4-8b68042fa5fa |
| Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpropan-1-one |
| SMILES (Canonical) | C1CCN(CC1)C(=O)CCC2=CC3=C(C=C2)OCO3 |
| SMILES (Isomeric) | C1CCN(CC1)C(=O)CCC2=CC3=C(C=C2)OCO3 |
| InChI | InChI=1S/C15H19NO3/c17-15(16-8-2-1-3-9-16)7-5-12-4-6-13-14(10-12)19-11-18-13/h4,6,10H,1-3,5,7-9,11H2 |
| InChI Key | XCBIVSYMPNVWRX-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 38.80 Ų |
| XlogP | 2.40 |
| CHEMBL2436900 |
| XCBIVSYMPNVWRX-UHFFFAOYSA-N |
| AKOS005249111 |
| 3-benzo-1,3-dioxol-5-ylpropionic Acid Piperidide |
| Z192601610 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.49% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.41% | 96.77% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.37% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.92% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.36% | 86.33% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 90.09% | 94.80% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.76% | 90.71% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.29% | 85.14% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.23% | 90.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.59% | 92.62% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 83.92% | 96.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.91% | 95.89% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 82.17% | 86.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.29% | 95.56% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.58% | 83.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper nigrum |
| PubChem | 9965088 |
| LOTUS | LTS0026754 |
| wikiData | Q105324867 |