[3-Amino-4-[3-[(2,3-dihydroxybenzoyl)amino]propylamino]-4-oxobutan-2-yl] 2,3-dihydroxybenzoate
| Internal ID | 0060a3fb-0f54-44d5-a2a4-e22ca5eab4d6 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acid amides |
| IUPAC Name | [3-amino-4-[3-[(2,3-dihydroxybenzoyl)amino]propylamino]-4-oxobutan-2-yl] 2,3-dihydroxybenzoate |
| SMILES (Canonical) | CC(C(C(=O)NCCCNC(=O)C1=C(C(=CC=C1)O)O)N)OC(=O)C2=C(C(=CC=C2)O)O |
| SMILES (Isomeric) | CC(C(C(=O)NCCCNC(=O)C1=C(C(=CC=C1)O)O)N)OC(=O)C2=C(C(=CC=C2)O)O |
| InChI | InChI=1S/C21H25N3O8/c1-11(32-21(31)13-6-3-8-15(26)18(13)28)16(22)20(30)24-10-4-9-23-19(29)12-5-2-7-14(25)17(12)27/h2-3,5-8,11,16,25-28H,4,9-10,22H2,1H3,(H,23,29)(H,24,30) |
| InChI Key | XMOBHOCBJPHBKD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H25N3O8 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.16416476 g/mol |
| Topological Polar Surface Area (TPSA) | 191.00 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.28% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.09% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.70% | 91.11% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.59% | 93.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.36% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.58% | 94.45% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.67% | 100.00% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 86.14% | 83.10% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.12% | 95.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.54% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.48% | 99.17% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.53% | 95.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.58% | 95.50% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.28% | 90.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.45% | 90.71% |
| CHEMBL3891 | P07384 | Calpain 1 | 80.36% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 124111081 |
| LOTUS | LTS0083873 |
| wikiData | Q104201140 |