[3-Amino-4-[[1-(1-carboxyethylamino)-1-oxopropan-2-yl]amino]-4-oxobutyl]-hydroxy-oxophosphanium
| Internal ID | dd3b4c6c-0c8f-4ab8-93d5-8fef28b604f1 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | [3-amino-4-[[1-(1-carboxyethylamino)-1-oxopropan-2-yl]amino]-4-oxobutyl]-hydroxy-oxophosphanium |
| SMILES (Canonical) | CC(C(=O)NC(C)C(=O)O)NC(=O)C(CC[P+](=O)O)N |
| SMILES (Isomeric) | CC(C(=O)NC(C)C(=O)O)NC(=O)C(CC[P+](=O)O)N |
| InChI | InChI=1S/C10H18N3O6P/c1-5(8(14)13-6(2)10(16)17)12-9(15)7(11)3-4-20(18)19/h5-7H,3-4,11H2,1-2H3,(H3-,12,13,14,15,16,17,18,19)/p+1 |
| InChI Key | TTZMSSHMHCSAMS-UHFFFAOYSA-O |
| Popularity | 0 references in papers |
| Molecular Formula | C10H19N3O6P+ |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.10114733 g/mol |
| Topological Polar Surface Area (TPSA) | 159.00 Ų |
| XlogP | -5.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.57% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.42% | 96.09% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 94.20% | 92.29% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.05% | 98.95% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 93.60% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.40% | 93.56% |
| CHEMBL236 | P41143 | Delta opioid receptor | 90.77% | 99.35% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.66% | 90.17% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.37% | 89.63% |
| CHEMBL3308 | P55212 | Caspase-6 | 87.48% | 97.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.22% | 99.17% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 87.15% | 97.23% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.36% | 96.47% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.08% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.61% | 96.95% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 83.36% | 96.03% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.24% | 89.50% |
| CHEMBL1907588 | P02708 | Acetylcholine receptor; alpha1/beta1/delta/gamma | 82.23% | 98.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.99% | 91.19% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.23% | 94.33% |
| CHEMBL233 | P35372 | Mu opioid receptor | 80.06% | 97.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 13366417 |
| LOTUS | LTS0088745 |
| wikiData | Q105264589 |