3-acetylamino-N-2-thienylpropanamide
| Internal ID | 40ae3e79-ffa4-47f2-8b15-467053fd4cf7 |
| Taxonomy | Organoheterocyclic compounds > Heteroaromatic compounds |
| IUPAC Name | 3-acetamido-N-thiophen-2-ylpropanamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C9H12N2O2S/c1-7(12)10-5-4-8(13)11-9-3-2-6-14-9/h2-3,6H,4-5H2,1H3,(H,10,12)(H,11,13) |
| InChI Key | UJPOOQANUYFCRO-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06194880 g/mol |
| Topological Polar Surface Area (TPSA) | 86.40 Ų |
| XlogP | 0.30 |
| 3-acetylamino-N-2-thienyl-propanamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.84% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.21% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.66% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.31% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.30% | 99.23% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.37% | 97.21% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.12% | 99.17% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 83.21% | 98.59% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.22% | 96.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.94% | 90.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.45% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.51% | 90.00% |
| CHEMBL2321614 | Q9NPC2 | Potassium channel subfamily K member 9 | 80.15% | 80.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139591621 |
| LOTUS | LTS0044969 |
| wikiData | Q104198284 |