3-Acetyl-5-isopropyl-2,4-pyrrolidinedione
| Internal ID | 43efd144-db93-415f-aa52-f8c57720ce49 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > 1,3-dicarbonyl compounds > Beta-diketones |
| IUPAC Name | 3-acetyl-5-propan-2-ylpyrrolidine-2,4-dione |
| SMILES (Canonical) | CC(C)C1C(=O)C(C(=O)N1)C(=O)C |
| SMILES (Isomeric) | CC(C)C1C(=O)C(C(=O)N1)C(=O)C |
| InChI | InChI=1S/C9H13NO3/c1-4(2)7-8(12)6(5(3)11)9(13)10-7/h4,6-7H,1-3H3,(H,10,13) |
| InChI Key | GBTIOVXDLJPTEH-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.08954328 g/mol |
| Topological Polar Surface Area (TPSA) | 63.20 Ų |
| XlogP | 0.60 |
| 3-Acetyl-5-isopropyl-2,4-pyrrolidinedione |
| 2,4-Pyrrolidinedione, 3-acetyl-5-isopropyl- |
| 3-acetyl-5-isopropylpyrrolidine-2,4-dione |
| DTXSID40990951 |
| 4-Acetyl-5-hydroxy-2-(propan-2-yl)-2,4-dihydro-3H-pyrrol-3-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.92% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.05% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.96% | 94.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.94% | 94.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.89% | 91.11% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.67% | 93.03% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.29% | 90.08% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.20% | 89.34% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.57% | 96.47% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.22% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 3083645 |
| LOTUS | LTS0043758 |
| wikiData | Q82980603 |