3-Acetyl-11-keto-beta-boswellicacid
Internal ID | 73dfe984-1adf-46b7-94d4-3eb97bbe614b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (3R,4R,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-3-acetyloxy-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicene-4-carboxylic acid |
SMILES (Canonical) | CC1CCC2(CCC3(C(=CC(=O)C4C3(CCC5C4(CCC(C5(C)C(=O)O)OC(=O)C)C)C)C2C1C)C)C |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC(=O)[C@H]4[C@]3(CCC5[C@@]4(CC[C@H]([C@]5(C)C(=O)O)OC(=O)C)C)C)[C@@H]2[C@H]1C)C)C |
InChI | InChI=1S/C32H48O5/c1-18-9-12-28(4)15-16-30(6)21(25(28)19(18)2)17-22(34)26-29(5)13-11-24(37-20(3)33)32(8,27(35)36)23(29)10-14-31(26,30)7/h17-19,23-26H,9-16H2,1-8H3,(H,35,36)/t18-,19+,23?,24-,25+,26-,28-,29+,30-,31-,32-/m1/s1 |
InChI Key | HMMGKOVEOFBCAU-XTTIIYOSSA-N |
Popularity | 122 references in papers |
Molecular Formula | C32H48O5 |
Molecular Weight | 512.70 g/mol |
Exact Mass | 512.35017463 g/mol |
Topological Polar Surface Area (TPSA) | 80.70 Ų |
XlogP | 7.20 |
3-O-acetyl-11-keto-boswellic acid |
HMMGKOVEOFBCAU-XTTIIYOSSA-N |
AKOS016010157 |
3-ACETYL-11-KETO-BETA-BOSWELLICACID |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 96.46% | 94.78% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.42% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.73% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 92.08% | 98.95% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.85% | 82.69% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.53% | 91.19% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.81% | 95.56% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.02% | 93.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.75% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.59% | 90.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.88% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.49% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.13% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Boswellia sacra |
Boswellia serrata |
PubChem | 71463896 |
LOTUS | LTS0210970 |
wikiData | Q104403488 |