3-(8-hydroxy-4-oxo-1H-quinazolin-2-yl)propanoic acid
| Internal ID | d68b4f9d-07e8-4d91-b29f-3de4a262767f |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinazolines |
| IUPAC Name | 3-(8-hydroxy-4-oxo-1H-quinazolin-2-yl)propanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H10N2O4/c14-7-3-1-2-6-10(7)12-8(13-11(6)17)4-5-9(15)16/h1-3,14H,4-5H2,(H,15,16)(H,12,13,17) |
| InChI Key | FEZOCIHDAJWHKN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06405680 g/mol |
| Topological Polar Surface Area (TPSA) | 99.00 Ų |
| XlogP | -0.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.51% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 96.19% | 94.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 95.23% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.37% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.07% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.04% | 95.56% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 91.15% | 97.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 88.83% | 90.08% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 87.83% | 90.20% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.04% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.64% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.15% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.69% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.71% | 89.63% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.38% | 86.33% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.25% | 91.71% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.21% | 93.99% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.89% | 94.62% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.21% | 95.56% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 80.00% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71504122 |
| LOTUS | LTS0079410 |
| wikiData | Q77567411 |