3-(7-Methoxy-1,3-benzodioxol-5-yl)phenol
| Internal ID | f5732608-0136-4b64-9437-d40fb288c97f |
| Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
| IUPAC Name | 3-(7-methoxy-1,3-benzodioxol-5-yl)phenol |
| SMILES (Canonical) | COC1=CC(=CC2=C1OCO2)C3=CC(=CC=C3)O |
| SMILES (Isomeric) | COC1=CC(=CC2=C1OCO2)C3=CC(=CC=C3)O |
| InChI | InChI=1S/C14H12O4/c1-16-12-6-10(7-13-14(12)18-8-17-13)9-3-2-4-11(15)5-9/h2-7,15H,8H2,1H3 |
| InChI Key | RZEQCWOSRBVTLN-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.07355886 g/mol |
| Topological Polar Surface Area (TPSA) | 47.90 Ų |
| XlogP | 3.00 |
| 3-(7-Methoxy-1,3-benzodioxol-5-yl)phenol |
| 3'-Hydroxy-5-methoxy-3,4-methylenedioxybiphenyl |
| Phenol,3-(7-methoxy-1,3-benzodioxol-5-yl)- |
| 3/'-Hydroxy-5-methoxy-3,4-methylenedioxybiphenyl |
| 3'-Hmmdb |
| DTXSID10159639 |
| NCGC00385846-01 |
| 3'-Hydroxy-3-methoxy-4,5-methylenedioxybiphenyl |
| 3-(7-Methoxybenzo[d][1,3]dioxol-5-yl)phenol |
| Phenol, 3-(7-methoxy-1,3-benzodioxol-5-yl)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.34% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.58% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.84% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.46% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.74% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.25% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.68% | 94.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.62% | 97.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.61% | 93.99% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.16% | 92.62% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.98% | 96.77% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.77% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.63% | 95.50% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 82.50% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.80% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.48% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Monnina salicifolia |
| PubChem | 126216 |
| LOTUS | LTS0168097 |
| wikiData | Q83028005 |