3-[5-Acetyloxy-2-[1-(4-acetyloxy-3-methoxyphenyl)prop-1-en-2-yl]-4-methoxyphenyl]prop-2-enyl acetate
Internal ID | 2465f91a-0fc3-4776-bc39-4d4d9cabdf71 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 3-[5-acetyloxy-2-[1-(4-acetyloxy-3-methoxyphenyl)prop-1-en-2-yl]-4-methoxyphenyl]prop-2-enyl acetate |
SMILES (Canonical) | CC(=CC1=CC(=C(C=C1)OC(=O)C)OC)C2=CC(=C(C=C2C=CCOC(=O)C)OC(=O)C)OC |
SMILES (Isomeric) | CC(=CC1=CC(=C(C=C1)OC(=O)C)OC)C2=CC(=C(C=C2C=CCOC(=O)C)OC(=O)C)OC |
InChI | InChI=1S/C26H28O8/c1-16(12-20-9-10-23(33-18(3)28)24(13-20)30-5)22-15-25(31-6)26(34-19(4)29)14-21(22)8-7-11-32-17(2)27/h7-10,12-15H,11H2,1-6H3 |
InChI Key | WKYJPURGQHUAMD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H28O8 |
Molecular Weight | 468.50 g/mol |
Exact Mass | 468.17841785 g/mol |
Topological Polar Surface Area (TPSA) | 97.40 Ų |
XlogP | 4.60 |
There are no found synonyms. |
![2D Structure of 3-[5-Acetyloxy-2-[1-(4-acetyloxy-3-methoxyphenyl)prop-1-en-2-yl]-4-methoxyphenyl]prop-2-enyl acetate 2D Structure of 3-[5-Acetyloxy-2-[1-(4-acetyloxy-3-methoxyphenyl)prop-1-en-2-yl]-4-methoxyphenyl]prop-2-enyl acetate](https://plantaedb.com/storage/docs/compounds/2023/11/3-5-acetyloxy-2-1-4-acetyloxy-3-methoxyphenylprop-1-en-2-yl-4-methoxyphenylprop-2-enyl-acetate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.50% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.79% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.04% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.47% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.32% | 91.11% |
CHEMBL2535 | P11166 | Glucose transporter | 88.66% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.41% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.93% | 95.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.32% | 94.73% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.57% | 89.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.36% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 83.08% | 98.95% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.46% | 89.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.24% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.10% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pinus taeda |
PubChem | 163034376 |
LOTUS | LTS0235643 |
wikiData | Q105307802 |