3-[5-(3,7-Dimethylocta-2,6-dienyl)-2,4-dihydroxyphenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one
Internal ID | 1d929067-b047-41df-8ea1-bce08e0d2184 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 3-prenylated isoflavanones |
IUPAC Name | 3-[5-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxyphenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCCC(=CCC1=CC(=C(C=C1O)O)C2COC3=CC(=CC(=C3C2=O)O)O)C)C |
SMILES (Isomeric) | CC(=CCCC(=CCC1=CC(=C(C=C1O)O)C2COC3=CC(=CC(=C3C2=O)O)O)C)C |
InChI | InChI=1S/C25H28O6/c1-14(2)5-4-6-15(3)7-8-16-9-18(21(28)12-20(16)27)19-13-31-23-11-17(26)10-22(29)24(23)25(19)30/h5,7,9-12,19,26-29H,4,6,8,13H2,1-3H3 |
InChI Key | WHMBQYBYAQQJRN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H28O6 |
Molecular Weight | 424.50 g/mol |
Exact Mass | 424.18858861 g/mol |
Topological Polar Surface Area (TPSA) | 107.00 Ų |
XlogP | 6.00 |
There are no found synonyms. |
![2D Structure of 3-[5-(3,7-Dimethylocta-2,6-dienyl)-2,4-dihydroxyphenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one 2D Structure of 3-[5-(3,7-Dimethylocta-2,6-dienyl)-2,4-dihydroxyphenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/3-5-37-dimethylocta-26-dienyl-24-dihydroxyphenyl-57-dihydroxy-23-dihydrochromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.54% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.95% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.90% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.57% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.81% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.75% | 94.73% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 90.57% | 93.10% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.86% | 94.45% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 89.61% | 96.12% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.52% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.75% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.18% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.58% | 86.33% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 87.55% | 92.08% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.06% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.92% | 90.71% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 86.22% | 92.68% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.13% | 97.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.22% | 94.80% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 82.15% | 92.51% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.75% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sophora koreensis |
PubChem | 85122337 |
LOTUS | LTS0196216 |
wikiData | Q105305418 |