3-(4-Methylphenyl)pyridine
| Internal ID | 27dc868b-08e2-4562-8d02-8e39b0731127 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Phenylpyridines |
| IUPAC Name | 3-(4-methylphenyl)pyridine |
| SMILES (Canonical) | CC1=CC=C(C=C1)C2=CN=CC=C2 |
| SMILES (Isomeric) | CC1=CC=C(C=C1)C2=CN=CC=C2 |
| InChI | InChI=1S/C12H11N/c1-10-4-6-11(7-5-10)12-3-2-8-13-9-12/h2-9H,1H3 |
| InChI Key | KUZNURGIXXKBEJ-UHFFFAOYSA-N |
| Popularity | 9 references in papers |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.089149355 g/mol |
| Topological Polar Surface Area (TPSA) | 12.90 Ų |
| XlogP | 2.80 |
| 4423-09-0 |
| 3-(p-tolyl)pyridine |
| 3-p-tolylpyridine |
| 4-(3-pyridyl)toluene |
| Pyridine, 3-(4-methylphenyl)- |
| PYRIDINE,3-(4-METHYLPHENYL)- |
| SCHEMBL4582701 |
| DTXSID20399706 |
| AMY32752 |
| MFCD04038775 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 92.53% | 93.65% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.96% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.50% | 91.49% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 89.37% | 81.11% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 86.44% | 93.31% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.38% | 86.33% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.93% | 97.36% |
| CHEMBL3769292 | Q9H773 | dCTP pyrophosphatase 1 | 83.79% | 94.40% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.71% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.96% | 90.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.93% | 94.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.67% | 85.30% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.85% | 94.62% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 80.70% | 92.51% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 4133189 |
| LOTUS | LTS0072853 |
| wikiData | Q82202402 |