3-(4-methylphenyl)-N-(2-phenylethyl)prop-2-enamide
| Internal ID | eb8cf3dd-d411-4938-aed4-e6669d453069 |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid amides |
| IUPAC Name | 3-(4-methylphenyl)-N-(2-phenylethyl)prop-2-enamide |
| SMILES (Canonical) | CC1=CC=C(C=C1)C=CC(=O)NCCC2=CC=CC=C2 |
| SMILES (Isomeric) | CC1=CC=C(C=C1)C=CC(=O)NCCC2=CC=CC=C2 |
| InChI | InChI=1S/C18H19NO/c1-15-7-9-17(10-8-15)11-12-18(20)19-14-13-16-5-3-2-4-6-16/h2-12H,13-14H2,1H3,(H,19,20) |
| InChI Key | CEGXCAVMQDPDRL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.146664230 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 3.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.74% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.93% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.00% | 95.56% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 92.07% | 92.51% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.19% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.60% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.25% | 96.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.12% | 94.73% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.69% | 95.50% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 88.68% | 96.67% |
| CHEMBL5028 | O14672 | ADAM10 | 87.54% | 97.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.79% | 99.17% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 84.23% | 89.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.16% | 91.11% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 81.21% | 81.11% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.95% | 96.25% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.53% | 93.81% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.22% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Uvaria dulcis |
| PubChem | 918090 |
| LOTUS | LTS0168562 |
| wikiData | Q104955672 |