3-[(4-Methoxyphenyl)methylidene]-6-(2-methylpropylidene)piperazine-2,5-dione
| Internal ID | b9f37010-6d44-4156-b84c-85591163facc |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | 3-[(4-methoxyphenyl)methylidene]-6-(2-methylpropylidene)piperazine-2,5-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H18N2O3/c1-10(2)8-13-15(19)18-14(16(20)17-13)9-11-4-6-12(21-3)7-5-11/h4-10H,1-3H3,(H,17,20)(H,18,19) |
| InChI Key | YRVUIYSTPTWLCY-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13174244 g/mol |
| Topological Polar Surface Area (TPSA) | 67.40 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
![2D Structure of 3-[(4-Methoxyphenyl)methylidene]-6-(2-methylpropylidene)piperazine-2,5-dione](https://plantaedb.com/storage/docs/compounds/2023/11/3-4-methoxyphenylmethylidene-6-2-methylpropylidenepiperazine-25-dione.jpg "2D Structure of 3-[(4-Methoxyphenyl)methylidene]-6-(2-methylpropylidene)piperazine-2,5-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.53% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.01% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.74% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.57% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.45% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.96% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.85% | 98.95% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.85% | 96.12% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.16% | 98.75% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.27% | 93.40% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.88% | 93.31% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.34% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.57% | 99.15% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.91% | 91.07% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 80.53% | 83.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 4377844 |
| LOTUS | LTS0223455 |
| wikiData | Q105353147 |