3-(4-Hydroxyphenyl)-6,7-dihydroxy coumarin
| Internal ID | 24a98782-fa0b-497a-8d57-66ccf00a42e0 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Hydroxyisoflavonoids |
| IUPAC Name | 6,7-dihydroxy-3-(4-hydroxyphenyl)chromen-2-one |
| SMILES (Canonical) | C1=CC(=CC=C1C2=CC3=CC(=C(C=C3OC2=O)O)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1C2=CC3=CC(=C(C=C3OC2=O)O)O)O |
| InChI | InChI=1S/C15H10O5/c16-10-3-1-8(2-4-10)11-5-9-6-12(17)13(18)7-14(9)20-15(11)19/h1-7,16-18H |
| InChI Key | YVUQIBOMEHZRBP-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.05282342 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 2.50 |
| 3-(4-hydroxyphenyl)-6,7-dihydroxy coumarin |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.89% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.80% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.02% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.75% | 94.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.91% | 91.49% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 88.82% | 98.35% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.03% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.75% | 89.00% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 84.15% | 97.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.12% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.47% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.45% | 99.17% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.96% | 95.64% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.48% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.09% | 94.75% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.82% | 93.10% |
| CHEMBL3194 | P02766 | Transthyretin | 81.05% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Selaginella tamariscina |
| PubChem | 15674295 |
| LOTUS | LTS0056986 |
| wikiData | Q105366014 |