3-(4-Hydroxy-3,5-dimethoxyphenyl)propanal
| Internal ID | f819ad3e-402d-4d49-8e45-5281a173c2e5 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)propanal |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H14O4/c1-14-9-6-8(4-3-5-12)7-10(15-2)11(9)13/h5-7,13H,3-4H2,1-2H3 |
| InChI Key | DPEYEJOFAHQWJI-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 1.20 |
| 80638-49-9 |
| DTXSID70336202 |
| RefChem:493119 |
| DTXCID80287291 |
| 882-338-6 |
| Propanal, 3-(4-hydroxy-3,5-dimethoxyphenyl) |
| Benzenepropanal, 4-hydroxy-3,5-dimethoxy- |
| 3-(4-HYDROXY-3,5-DIMETHOXY-PHENYL)-PROPIONALDEHYDE |
| Benzenepropanal,4-hydroxy-3,5-dimethoxy- |
| SCHEMBL15238542 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.40% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.48% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.03% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.38% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.29% | 86.33% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 88.44% | 98.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.66% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.78% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.39% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.02% | 96.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.30% | 85.14% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.90% | 90.20% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.65% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sorbus aucuparia |
| PubChem | 529898 |
| LOTUS | LTS0172850 |
| wikiData | Q82103135 |