3-(4-hydroxy-3-methoxyphenyl)-N-[2-(3-hydroxy-4-methoxyphenyl)ethyl]prop-2-enamide
Internal ID | 010348f7-7734-4330-941e-962385026635 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives |
IUPAC Name | 3-(4-hydroxy-3-methoxyphenyl)-N-[2-(3-hydroxy-4-methoxyphenyl)ethyl]prop-2-enamide |
SMILES (Canonical) | COC1=C(C=C(C=C1)CCNC(=O)C=CC2=CC(=C(C=C2)O)OC)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1)CCNC(=O)C=CC2=CC(=C(C=C2)O)OC)O |
InChI | InChI=1S/C19H21NO5/c1-24-17-7-4-14(11-16(17)22)9-10-20-19(23)8-5-13-3-6-15(21)18(12-13)25-2/h3-8,11-12,21-22H,9-10H2,1-2H3,(H,20,23) |
InChI Key | ACSWAJLDOHJFNA-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C19H21NO5 |
Molecular Weight | 343.40 g/mol |
Exact Mass | 343.14197277 g/mol |
Topological Polar Surface Area (TPSA) | 88.00 Ų |
XlogP | 2.10 |
There are no found synonyms. |
![2D Structure of 3-(4-hydroxy-3-methoxyphenyl)-N-[2-(3-hydroxy-4-methoxyphenyl)ethyl]prop-2-enamide 2D Structure of 3-(4-hydroxy-3-methoxyphenyl)-N-[2-(3-hydroxy-4-methoxyphenyl)ethyl]prop-2-enamide](https://plantaedb.com/storage/docs/compounds/2023/11/3-4-hydroxy-3-methoxyphenyl-n-2-3-hydroxy-4-methoxyphenylethylprop-2-enamide.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.82% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.68% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.51% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.67% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.68% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 93.53% | 98.95% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 93.46% | 90.20% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.13% | 90.00% |
CHEMBL3194 | P02766 | Transthyretin | 88.55% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 88.13% | 98.75% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.13% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.44% | 94.45% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 86.09% | 89.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.48% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.96% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.81% | 89.00% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 82.04% | 96.67% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.96% | 90.71% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.39% | 90.24% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.01% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chenopodium album |
Pisonia umbellifera |
PubChem | 67111365 |
LOTUS | LTS0198895 |
wikiData | Q104909271 |