3-[4-(4-Hydroxy-3-nitrosobenzoyl)oxyphenyl]prop-2-enoic acid
| Internal ID | e8e150c7-3761-4572-9918-8bb446ce7e44 |
| Taxonomy | Phenylpropanoids and polyketides > Depsides and depsidones |
| IUPAC Name | 3-[4-(4-hydroxy-3-nitrosobenzoyl)oxyphenyl]prop-2-enoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H11NO6/c18-14-7-4-11(9-13(14)17-22)16(21)23-12-5-1-10(2-6-12)3-8-15(19)20/h1-9,18H,(H,19,20) |
| InChI Key | KZOPHCFMEGMURT-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H11NO6 |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.05863707 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of 3-[4-(4-Hydroxy-3-nitrosobenzoyl)oxyphenyl]prop-2-enoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/3-4-4-hydroxy-3-nitrosobenzoyloxyphenylprop-2-enoic-acid.jpg "2D Structure of 3-[4-(4-Hydroxy-3-nitrosobenzoyl)oxyphenyl]prop-2-enoic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.02% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.08% | 91.49% |
| CHEMBL3194 | P02766 | Transthyretin | 96.11% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.50% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.22% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.02% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.13% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.12% | 93.99% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.73% | 96.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.75% | 98.75% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.55% | 91.71% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 84.01% | 89.49% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 82.81% | 97.64% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 80.00% | 85.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 72495717 |
| LOTUS | LTS0053704 |
| wikiData | Q104170730 |