[3-[4-(3-Methylbutanoyloxy)phenyl]oxiran-2-yl]methyl 3-methylbutanoate
Internal ID | ccc664ac-f0f1-4f9d-9865-a6c42df704fe |
Taxonomy | Benzenoids > Phenol esters |
IUPAC Name | [3-[4-(3-methylbutanoyloxy)phenyl]oxiran-2-yl]methyl 3-methylbutanoate |
SMILES (Canonical) | CC(C)CC(=O)OCC1C(O1)C2=CC=C(C=C2)OC(=O)CC(C)C |
SMILES (Isomeric) | CC(C)CC(=O)OCC1C(O1)C2=CC=C(C=C2)OC(=O)CC(C)C |
InChI | InChI=1S/C19H26O5/c1-12(2)9-17(20)22-11-16-19(24-16)14-5-7-15(8-6-14)23-18(21)10-13(3)4/h5-8,12-13,16,19H,9-11H2,1-4H3 |
InChI Key | YNXFRMYLAKMNTG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H26O5 |
Molecular Weight | 334.40 g/mol |
Exact Mass | 334.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 65.10 Ų |
XlogP | 3.60 |
There are no found synonyms. |
![2D Structure of [3-[4-(3-Methylbutanoyloxy)phenyl]oxiran-2-yl]methyl 3-methylbutanoate 2D Structure of [3-[4-(3-Methylbutanoyloxy)phenyl]oxiran-2-yl]methyl 3-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/3-4-3-methylbutanoyloxyphenyloxiran-2-ylmethyl-3-methylbutanoate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.58% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.82% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.99% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.56% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 91.36% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.71% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.98% | 99.17% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.34% | 83.82% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.82% | 95.93% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.67% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.22% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anisopappus pinnatifida |
PubChem | 14287126 |
LOTUS | LTS0125987 |
wikiData | Q105351145 |