3-(3,7,11-Trimethyl-2,6,10-dodecatrienyl)-1H-indole
| Internal ID | cbc804b8-9bbf-47fa-817f-08fad1ff2249 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-indole |
| SMILES (Canonical) | CC(=CCCC(=CCCC(=CCC1=CNC2=CC=CC=C21)C)C)C |
| SMILES (Isomeric) | CC(=CCC/C(=C/CC/C(=C/CC1=CNC2=CC=CC=C21)/C)/C)C |
| InChI | InChI=1S/C23H31N/c1-18(2)9-7-10-19(3)11-8-12-20(4)15-16-21-17-24-23-14-6-5-13-22(21)23/h5-6,9,11,13-15,17,24H,7-8,10,12,16H2,1-4H3/b19-11+,20-15+ |
| InChI Key | GIEWHHJZPKZOFH-NKFKFSAASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H31N |
| Molecular Weight | 321.50 g/mol |
| Exact Mass | 321.245649993 g/mol |
| Topological Polar Surface Area (TPSA) | 15.80 Ų |
| XlogP | 7.90 |
| 3-(3,7,11-Trimethyl-2,6,10-dodecatrienyl)-1H-indole |
| 3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-indole |
| NSC-635114 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.94% | 91.11% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 97.01% | 92.08% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.81% | 98.95% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.55% | 94.62% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.52% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.33% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.44% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.41% | 91.49% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 87.19% | 95.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.19% | 90.17% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 83.84% | 95.56% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 82.64% | 88.56% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.56% | 83.10% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.04% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Uvaria pandensis |
| PubChem | 5388343 |
| LOTUS | LTS0112987 |
| wikiData | Q105008915 |