3-[(3,5,6-trimethylpyrazin-2-yl)methylidene]-1H-indol-2-one
| Internal ID | 89c46c21-7c3d-4cc9-9d2d-a5f7e6bbf9c9 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolines |
| IUPAC Name | 3-[(3,5,6-trimethylpyrazin-2-yl)methylidene]-1H-indol-2-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H15N3O/c1-9-10(2)18-15(11(3)17-9)8-13-12-6-4-5-7-14(12)19-16(13)20/h4-8H,1-3H3,(H,19,20) |
| InChI Key | UPOJQOAXPUNQHS-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.121512110 g/mol |
| Topological Polar Surface Area (TPSA) | 54.90 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 96.33% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.87% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.74% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.29% | 99.23% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 90.99% | 92.97% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.18% | 89.63% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 90.14% | 93.03% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 88.74% | 96.47% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.63% | 91.49% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.02% | 85.14% |
| CHEMBL4237 | O75582 | Ribosomal protein S6 kinase alpha 5 | 86.84% | 91.00% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 86.66% | 95.70% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.13% | 94.62% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.98% | 94.08% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.43% | 86.33% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 83.13% | 92.51% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.12% | 93.65% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 82.01% | 96.39% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.77% | 96.67% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 81.38% | 96.25% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.52% | 85.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163082021 |
| LOTUS | LTS0239358 |
| wikiData | Q104198624 |