3-[(3,5-Dichloro-4-hydroxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
| Internal ID | d1b51a04-427d-42c7-abe7-0a614177e323 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | 3-[(3,5-dichloro-4-hydroxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H14Cl2N2O3/c15-8-4-7(5-9(16)12(8)19)6-10-14(21)18-3-1-2-11(18)13(20)17-10/h4-5,10-11,19H,1-3,6H2,(H,17,20) |
| InChI Key | QLJFYTMVYIVQDQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H14Cl2N2O3 |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.0381477 g/mol |
| Topological Polar Surface Area (TPSA) | 69.60 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.34% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.05% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.70% | 91.11% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 95.56% | 95.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.00% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.46% | 95.89% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.04% | 93.03% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.73% | 97.09% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.72% | 93.40% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.41% | 90.71% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.36% | 85.14% |
| CHEMBL5905 | Q04828 | Aldo-keto reductase family 1 member C1 | 86.82% | 91.79% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 86.43% | 91.76% |
| CHEMBL238 | Q01959 | Dopamine transporter | 86.31% | 95.88% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 86.21% | 99.18% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.19% | 95.56% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.30% | 89.34% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.13% | 86.33% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 83.67% | 97.64% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 83.28% | 80.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.04% | 90.08% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.66% | 97.25% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 81.49% | 96.11% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.28% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 74975801 |
| LOTUS | LTS0132978 |
| wikiData | Q104195936 |