3-[(3,4-Dihydroxyphenyl)methyl]-6,7-dihydroxychromen-2-one
| Internal ID | cdeba609-c0e3-4d5f-bd8c-a5183589b553 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Hydroxycoumarins > 6,7-dihydroxycoumarins |
| IUPAC Name | 3-[(3,4-dihydroxyphenyl)methyl]-6,7-dihydroxychromen-2-one |
| SMILES (Canonical) | C1=CC(=C(C=C1CC2=CC3=CC(=C(C=C3OC2=O)O)O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1CC2=CC3=CC(=C(C=C3OC2=O)O)O)O)O |
| InChI | InChI=1S/C16H12O6/c17-11-2-1-8(4-12(11)18)3-10-5-9-6-13(19)14(20)7-15(9)22-16(10)21/h1-2,4-7,17-20H,3H2 |
| InChI Key | SYZWBXUQWCQGNT-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 107.00 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.88% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.37% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.12% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.02% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.21% | 94.73% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.80% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.67% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.19% | 90.71% |
| CHEMBL3706 | P78536 | ADAM17 | 82.32% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.14% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.34% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Baccharis latifolia |
| Onychium japonicum |
| PubChem | 123684269 |
| LOTUS | LTS0082858 |
| wikiData | Q105032719 |