3-(3,4-dihydro-2H-furo[2,3-h]chromen-3-yl)-2,6-dimethoxyphenol
| Internal ID | 04e91d14-f8d6-474f-b4cd-3b6cff7cc4c0 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > O-methylated isoflavonoids > 4-O-methylated isoflavonoids > 3-hydroxy,4-methoxyisoflavonoids |
| IUPAC Name | 3-(3,4-dihydro-2H-furo[2,3-h]chromen-3-yl)-2,6-dimethoxyphenol |
| SMILES (Canonical) | COC1=C(C(=C(C=C1)C2CC3=C(C4=C(C=C3)OC=C4)OC2)OC)O |
| SMILES (Isomeric) | COC1=C(C(=C(C=C1)C2CC3=C(C4=C(C=C3)OC=C4)OC2)OC)O |
| InChI | InChI=1S/C19H18O5/c1-21-16-6-4-13(19(22-2)17(16)20)12-9-11-3-5-15-14(7-8-23-15)18(11)24-10-12/h3-8,12,20H,9-10H2,1-2H3 |
| InChI Key | DGWRIGGEKQHRTA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 61.10 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of 3-(3,4-dihydro-2H-furo[2,3-h]chromen-3-yl)-2,6-dimethoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/3-34-dihydro-2h-furo23-hchromen-3-yl-26-dimethoxyphenol.jpg "2D Structure of 3-(3,4-dihydro-2H-furo[2,3-h]chromen-3-yl)-2,6-dimethoxyphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.40% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.52% | 91.11% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 95.41% | 94.03% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 93.42% | 89.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.91% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.63% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.79% | 85.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.49% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.87% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.50% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.62% | 95.56% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.12% | 93.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.11% | 86.33% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 86.00% | 91.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.81% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.18% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.05% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.32% | 97.09% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.91% | 95.78% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.68% | 82.67% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 82.21% | 95.12% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.20% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Smirnowia turkestana |
| PubChem | 21599439 |
| LOTUS | LTS0220856 |
| wikiData | Q104979418 |