3-(3-methylbut-2-en-1-yl)-3H-purin-6-amine
| Internal ID | 0747591f-4e08-414f-9515-8ec0fcc6f370 |
| Taxonomy | Organoheterocyclic compounds > Imidazopyrimidines > Purines and purine derivatives |
| IUPAC Name | 3-(3-methylbut-2-enyl)-7H-purin-6-imine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H13N5/c1-7(2)3-4-15-6-14-9(11)8-10(15)13-5-12-8/h3,5-6,11H,4H2,1-2H3,(H,12,13) |
| InChI Key | DEAOYWWBDXWSOD-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11709544 g/mol |
| Topological Polar Surface Area (TPSA) | 68.10 Ų |
| XlogP | 1.30 |
| 10091-84-6 |
| Oprea1_038329 |
| 3-(3-Methyl-2-butenyl)-3H-purin-6-amine |
| 3-(3-methylbut-2-enyl)-7H-purin-6-imine |
| AC1Q1NVV |
| 3-(3-methylbut-2-enyl)purin-6-amine |
| Triacanthin |
| ZINC00002209 |
| SureCN11076308 |
| 6-amino-3-dimethylallylpurine |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.26% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.25% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.65% | 94.73% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.27% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.14% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.96% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.89% | 90.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.53% | 85.30% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 80.30% | 91.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gleditsia triacanthos |
| PubChem | 135438588 |
| LOTUS | LTS0210647 |
| wikiData | Q104250302 |