3-(3-Ethylpiperidin-4-yl)-1-quinolin-4-ylpropan-1-ol
| Internal ID | 8a8df821-41e4-49e9-b61c-39f7c9f90cc3 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > 4-quinolinemethanols |
| IUPAC Name | 3-(3-ethylpiperidin-4-yl)-1-quinolin-4-ylpropan-1-ol |
| SMILES (Canonical) | CCC1CNCCC1CCC(C2=CC=NC3=CC=CC=C23)O |
| SMILES (Isomeric) | CCC1CNCCC1CCC(C2=CC=NC3=CC=CC=C23)O |
| InChI | InChI=1S/C19H26N2O/c1-2-14-13-20-11-9-15(14)7-8-19(22)17-10-12-21-18-6-4-3-5-16(17)18/h3-6,10,12,14-15,19-20,22H,2,7-9,11,13H2,1H3 |
| InChI Key | XOAMWQARNBDKLD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.204513457 g/mol |
| Topological Polar Surface Area (TPSA) | 45.20 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.56% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.91% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.82% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.50% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.09% | 91.11% |
| CHEMBL228 | P31645 | Serotonin transporter | 92.20% | 95.51% |
| CHEMBL222 | P23975 | Norepinephrine transporter | 88.77% | 96.06% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.14% | 98.59% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.06% | 89.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.52% | 90.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.23% | 97.25% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 84.43% | 98.33% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.22% | 89.62% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.78% | 100.00% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.34% | 95.83% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.63% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.59% | 98.75% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.19% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ladenbergia oblongifolia |
| PubChem | 162961549 |
| LOTUS | LTS0219605 |
| wikiData | Q105337649 |