3-[3-[5-(2,3-Dihydroxypropyl)-2-hydroxyphenyl]-4-hydroxyphenyl]prop-2-enal
Internal ID | 01c18c4b-bbf5-4c85-803b-762081b754bb |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives |
IUPAC Name | 3-[3-[5-(2,3-dihydroxypropyl)-2-hydroxyphenyl]-4-hydroxyphenyl]prop-2-enal |
SMILES (Canonical) | C1=CC(=C(C=C1CC(CO)O)C2=C(C=CC(=C2)C=CC=O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1CC(CO)O)C2=C(C=CC(=C2)C=CC=O)O)O |
InChI | InChI=1S/C18H18O5/c19-7-1-2-12-3-5-17(22)15(9-12)16-10-13(4-6-18(16)23)8-14(21)11-20/h1-7,9-10,14,20-23H,8,11H2 |
InChI Key | NHIYVGKMRUPRNM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H18O5 |
Molecular Weight | 314.30 g/mol |
Exact Mass | 314.11542367 g/mol |
Topological Polar Surface Area (TPSA) | 98.00 Ų |
XlogP | 1.70 |
There are no found synonyms. |
![2D Structure of 3-[3-[5-(2,3-Dihydroxypropyl)-2-hydroxyphenyl]-4-hydroxyphenyl]prop-2-enal 2D Structure of 3-[3-[5-(2,3-Dihydroxypropyl)-2-hydroxyphenyl]-4-hydroxyphenyl]prop-2-enal](https://plantaedb.com/storage/docs/compounds/2023/11/3-3-5-23-dihydroxypropyl-2-hydroxyphenyl-4-hydroxyphenylprop-2-enal.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.04% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 95.61% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.68% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.75% | 95.56% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.80% | 91.71% |
CHEMBL3194 | P02766 | Transthyretin | 90.47% | 90.71% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 90.46% | 90.24% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.86% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.76% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.59% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.50% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.70% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.34% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.84% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.17% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Magnolia officinalis |
PubChem | 78385234 |
LOTUS | LTS0270325 |
wikiData | Q105179396 |