3-[3-(3,7-Dimethylocta-2,6-dienyl)-2-hydroxy-4-methoxyphenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one
Internal ID | 46e37dd8-a252-409b-90cf-1993d44434c6 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 3-prenylated isoflavanones |
IUPAC Name | 3-[3-(3,7-dimethylocta-2,6-dienyl)-2-hydroxy-4-methoxyphenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCCC(=CCC1=C(C=CC(=C1O)C2COC3=CC(=CC(=C3C2=O)O)O)OC)C)C |
SMILES (Isomeric) | CC(=CCCC(=CCC1=C(C=CC(=C1O)C2COC3=CC(=CC(=C3C2=O)O)O)OC)C)C |
InChI | InChI=1S/C26H30O6/c1-15(2)6-5-7-16(3)8-9-19-22(31-4)11-10-18(25(19)29)20-14-32-23-13-17(27)12-21(28)24(23)26(20)30/h6,8,10-13,20,27-29H,5,7,9,14H2,1-4H3 |
InChI Key | XMXLLMPLRJNCHB-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C26H30O6 |
Molecular Weight | 438.50 g/mol |
Exact Mass | 438.20423867 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 6.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.35% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.88% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 97.51% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.52% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.07% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.01% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.46% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.46% | 95.89% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 90.37% | 96.12% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.71% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.56% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.07% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.73% | 100.00% |
CHEMBL240 | Q12809 | HERG | 87.72% | 89.76% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.22% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.00% | 91.19% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.18% | 85.14% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 85.09% | 92.08% |
CHEMBL2535 | P11166 | Glucose transporter | 84.12% | 98.75% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.05% | 92.68% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.11% | 94.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.79% | 95.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.40% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.64% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.21% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Campylotropis hirtella |
PubChem | 74957399 |
LOTUS | LTS0223273 |
wikiData | Q105331493 |