3-[3-(2-Hydroxy-5-methoxyphenyl)prop-2-enyl]-2,6-dimethoxyphenol
| Internal ID | bdd0ed56-81e2-489f-ac7c-e5dbee3a53ba |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Cinnamylphenols |
| IUPAC Name | 3-[3-(2-hydroxy-5-methoxyphenyl)prop-2-enyl]-2,6-dimethoxyphenol |
| SMILES (Canonical) | COC1=CC(=C(C=C1)O)C=CCC2=C(C(=C(C=C2)OC)O)OC |
| SMILES (Isomeric) | COC1=CC(=C(C=C1)O)C=CCC2=C(C(=C(C=C2)OC)O)OC |
| InChI | InChI=1S/C18H20O5/c1-21-14-8-9-15(19)13(11-14)6-4-5-12-7-10-16(22-2)17(20)18(12)23-3/h4,6-11,19-20H,5H2,1-3H3 |
| InChI Key | NSKDJRUUEJWZEF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of 3-[3-(2-Hydroxy-5-methoxyphenyl)prop-2-enyl]-2,6-dimethoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/3-3-2-hydroxy-5-methoxyphenylprop-2-enyl-26-dimethoxyphenol.jpg "2D Structure of 3-[3-(2-Hydroxy-5-methoxyphenyl)prop-2-enyl]-2,6-dimethoxyphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.44% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.17% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.90% | 86.33% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 92.85% | 98.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.10% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.92% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.50% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.83% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.15% | 90.20% |
| CHEMBL3194 | P02766 | Transthyretin | 85.40% | 90.71% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.00% | 89.62% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.41% | 93.31% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.19% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.97% | 98.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.23% | 93.99% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.13% | 90.24% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.70% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.42% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dalbergia lanceolaria subsp. paniculata |
| PubChem | 73095177 |
| LOTUS | LTS0206135 |
| wikiData | Q105185091 |