3-[(2R,4R)-2-pyridin-3-ylpiperidin-4-yl]pyridine
Internal ID | d539803a-b285-441e-9ec2-97758f88088e |
Taxonomy | Alkaloids and derivatives |
IUPAC Name | 3-[(2R,4R)-2-pyridin-3-ylpiperidin-4-yl]pyridine |
SMILES (Canonical) | C1CNC(CC1C2=CN=CC=C2)C3=CN=CC=C3 |
SMILES (Isomeric) | C1CN[C@H](C[C@@H]1C2=CN=CC=C2)C3=CN=CC=C3 |
InChI | InChI=1S/C15H17N3/c1-3-13(10-16-6-1)12-5-8-18-15(9-12)14-4-2-7-17-11-14/h1-4,6-7,10-12,15,18H,5,8-9H2/t12-,15-/m1/s1 |
InChI Key | COWQBMIVVHLMNO-IUODEOHRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H17N3 |
Molecular Weight | 239.32 g/mol |
Exact Mass | 239.142247555 g/mol |
Topological Polar Surface Area (TPSA) | 37.80 Ų |
XlogP | 1.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 99.24% | 94.55% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.06% | 97.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 93.53% | 97.79% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.29% | 96.09% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 88.74% | 92.51% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.38% | 94.45% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 85.28% | 98.59% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.15% | 91.49% |
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 84.45% | 91.73% |
CHEMBL228 | P31645 | Serotonin transporter | 84.08% | 95.51% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.52% | 95.89% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 82.99% | 97.23% |
CHEMBL3920 | Q04759 | Protein kinase C theta | 82.02% | 97.69% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.74% | 80.96% |
CHEMBL222 | P23975 | Norepinephrine transporter | 81.61% | 96.06% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.47% | 92.88% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.15% | 97.25% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.85% | 85.30% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nicotiana tabacum |
PubChem | 40490605 |
LOTUS | LTS0171682 |
wikiData | Q104967343 |