3-[2,5-Dimethoxy-4-(2-methylbut-2-enoyloxy)phenyl]prop-2-enyl 2-methylbut-2-enoate
| Internal ID | 2bc78824-5f78-4e43-8f1e-3e0dea2ad143 |
| Taxonomy | Benzenoids > Phenol esters |
| IUPAC Name | 3-[2,5-dimethoxy-4-(2-methylbut-2-enoyloxy)phenyl]prop-2-enyl 2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OCC=CC1=CC(=C(C=C1OC)OC(=O)C(=CC)C)OC |
| SMILES (Isomeric) | CC=C(C)C(=O)OCC=CC1=CC(=C(C=C1OC)OC(=O)C(=CC)C)OC |
| InChI | InChI=1S/C21H26O6/c1-7-14(3)20(22)26-11-9-10-16-12-18(25-6)19(13-17(16)24-5)27-21(23)15(4)8-2/h7-10,12-13H,11H2,1-6H3 |
| InChI Key | GRVXDVYRXHDMFS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 71.10 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
![2D Structure of 3-[2,5-Dimethoxy-4-(2-methylbut-2-enoyloxy)phenyl]prop-2-enyl 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/3-25-dimethoxy-4-2-methylbut-2-enoyloxyphenylprop-2-enyl-2-methylbut-2-enoate.jpg "2D Structure of 3-[2,5-Dimethoxy-4-(2-methylbut-2-enoyloxy)phenyl]prop-2-enyl 2-methylbut-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.91% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.47% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.42% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.22% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.97% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.57% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.77% | 94.45% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.52% | 96.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.39% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.37% | 95.56% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.05% | 91.07% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.81% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.24% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Blumea lacera |
| PubChem | 162924665 |
| LOTUS | LTS0075007 |
| wikiData | Q105016611 |