3-(2,4-Dihydroxyphenyl)-8,8-dimethyl-2,3-dihydropyrano[2,3-f]chromen-4-one
Internal ID | bfbdfc86-1de2-4b66-8385-b2f3328750da |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 8-prenylated isoflavanones |
IUPAC Name | 3-(2,4-dihydroxyphenyl)-8,8-dimethyl-2,3-dihydropyrano[2,3-f]chromen-4-one |
SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC3=C2OCC(C3=O)C4=C(C=C(C=C4)O)O)C |
SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC3=C2OCC(C3=O)C4=C(C=C(C=C4)O)O)C |
InChI | InChI=1S/C20H18O5/c1-20(2)8-7-13-17(25-20)6-5-14-18(23)15(10-24-19(13)14)12-4-3-11(21)9-16(12)22/h3-9,15,21-22H,10H2,1-2H3 |
InChI Key | SFIMWOHAIWWSQJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H18O5 |
Molecular Weight | 338.40 g/mol |
Exact Mass | 338.11542367 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 3.30 |
There are no found synonyms. |
![2D Structure of 3-(2,4-Dihydroxyphenyl)-8,8-dimethyl-2,3-dihydropyrano[2,3-f]chromen-4-one 2D Structure of 3-(2,4-Dihydroxyphenyl)-8,8-dimethyl-2,3-dihydropyrano[2,3-f]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/3-24-dihydroxyphenyl-88-dimethyl-23-dihydropyrano23-fchromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.81% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.73% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.26% | 89.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.76% | 93.40% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.29% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.75% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.41% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.19% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.29% | 99.23% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.00% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.25% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.82% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.97% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.79% | 94.75% |
CHEMBL2535 | P11166 | Glucose transporter | 84.11% | 98.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.61% | 85.14% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.31% | 93.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.84% | 91.49% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.78% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.15% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.48% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.08% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycyrrhiza glabra |
PubChem | 11221431 |
LOTUS | LTS0084911 |
wikiData | Q105251771 |