3-(2,3,10-Trihydroxybenzo[b][1]benzoxepin-7-yl)prop-2-enoic acid
Internal ID | 309786b6-a3bf-4cf6-97ea-f2d595fb4839 |
Taxonomy | Organoheterocyclic compounds > Benzoxepines > Dibenzoxepines |
IUPAC Name | 3-(2,3,10-trihydroxybenzo[b][1]benzoxepin-7-yl)prop-2-enoic acid |
SMILES (Canonical) | C1=CC2=C(C=CC(=C2OC3=CC(=C(C=C31)O)O)O)C=CC(=O)O |
SMILES (Isomeric) | C1=CC2=C(C=CC(=C2OC3=CC(=C(C=C31)O)O)O)C=CC(=O)O |
InChI | InChI=1S/C17H12O6/c18-12-5-2-9(3-6-16(21)22)11-4-1-10-7-13(19)14(20)8-15(10)23-17(11)12/h1-8,18-20H,(H,21,22) |
InChI Key | QOUSSKPKMYDXFC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H12O6 |
Molecular Weight | 312.27 g/mol |
Exact Mass | 312.06338810 g/mol |
Topological Polar Surface Area (TPSA) | 107.00 Ų |
XlogP | 2.80 |
There are no found synonyms. |
![2D Structure of 3-(2,3,10-Trihydroxybenzo[b][1]benzoxepin-7-yl)prop-2-enoic acid 2D Structure of 3-(2,3,10-Trihydroxybenzo[b][1]benzoxepin-7-yl)prop-2-enoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/3-2310-trihydroxybenzob1benzoxepin-7-ylprop-2-enoic-acid.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.43% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 94.73% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.31% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.26% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.83% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.35% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.29% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.79% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.44% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.38% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.69% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.52% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Heliotropium sarmentosum |
PubChem | 85094112 |
LOTUS | LTS0091354 |
wikiData | Q105225134 |