3-(2-Methylpropyl)-1,4-diazonane-2,5-dione
| Internal ID | 878975bf-b7ae-40d7-853d-32a990a66a78 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | 3-(2-methylpropyl)-1,4-diazonane-2,5-dione |
| SMILES (Canonical) | CC(C)CC1C(=O)NCCCCC(=O)N1 |
| SMILES (Isomeric) | CC(C)CC1C(=O)NCCCCC(=O)N1 |
| InChI | InChI=1S/C11H20N2O2/c1-8(2)7-9-11(15)12-6-4-3-5-10(14)13-9/h8-9H,3-7H2,1-2H3,(H,12,15)(H,13,14) |
| InChI Key | LPEJYDOQHAUJGY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.152477885 g/mol |
| Topological Polar Surface Area (TPSA) | 58.20 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.05% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.74% | 97.25% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.40% | 90.08% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.58% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.39% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.42% | 94.75% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 88.04% | 92.97% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 87.85% | 88.56% |
| CHEMBL4616 | Q92847 | Ghrelin receptor | 85.96% | 92.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.27% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.85% | 95.56% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.41% | 83.82% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.21% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163110851 |
| LOTUS | LTS0195280 |
| wikiData | Q105155132 |