3-(2-Hydroxyethoxy)-9H-xanthen-9-one
Internal ID | 6de4e3d4-75d2-4384-a588-09979badaf67 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 3-(2-hydroxyethoxy)xanthen-9-one |
SMILES (Canonical) | C1=CC=C2C(=C1)C(=O)C3=C(O2)C=C(C=C3)OCCO |
SMILES (Isomeric) | C1=CC=C2C(=C1)C(=O)C3=C(O2)C=C(C=C3)OCCO |
InChI | InChI=1S/C15H12O4/c16-7-8-18-10-5-6-12-14(9-10)19-13-4-2-1-3-11(13)15(12)17/h1-6,9,16H,7-8H2 |
InChI Key | SCGUXZHIYPNDEG-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H12O4 |
Molecular Weight | 256.25 g/mol |
Exact Mass | 256.07355886 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 2.90 |
3-(2-HYDROXYETHOXY)-9H-XANTHEN-9-ONE |
DTXSID10802032 |
![2D Structure of 3-(2-Hydroxyethoxy)-9H-xanthen-9-one 2D Structure of 3-(2-Hydroxyethoxy)-9H-xanthen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/3-2-hydroxyethoxy-9h-xanthen-9-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.87% | 94.00% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 94.14% | 92.51% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.50% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.36% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.10% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 89.57% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.95% | 94.73% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 88.45% | 92.67% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.97% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.64% | 99.15% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.22% | 94.62% |
CHEMBL4531 | P17931 | Galectin-3 | 84.57% | 96.90% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.11% | 92.62% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.10% | 93.31% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.93% | 86.92% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.51% | 95.50% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.26% | 80.78% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 80.65% | 92.98% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hedychium gardnerianum |
PubChem | 71379467 |
LOTUS | LTS0158417 |
wikiData | Q82775546 |