3-(16-Methylheptadec-1-enoxy)propane-1,2-diol
| Internal ID | f4b48ea2-ccb0-4a3a-a567-185ef5a7c378 |
| Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Glycerol vinyl ethers |
| IUPAC Name | 3-(16-methylheptadec-1-enoxy)propane-1,2-diol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C21H42O3/c1-20(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-24-19-21(23)18-22/h15,17,20-23H,3-14,16,18-19H2,1-2H3 |
| InChI Key | DFQUASFMMMHMNW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H42O3 |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.31339520 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 7.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.60% | 97.29% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.25% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.23% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.97% | 99.17% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 91.21% | 87.45% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.14% | 94.45% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 86.20% | 93.31% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.99% | 93.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.01% | 96.00% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 84.10% | 92.95% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.46% | 96.47% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.53% | 94.73% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.92% | 89.34% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.13% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162904577 |
| LOTUS | LTS0136633 |
| wikiData | Q104978239 |