3-(1,3-Benzodioxol-5-ylmethyl)-2,5,7-trihydroxy-6,8-dimethyl-2,3-dihydrochromen-4-one
| Internal ID | ba132e69-febb-4c6c-8403-8776836d5c94 |
| Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids > Homoisoflavans > Homoisoflavanones |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-2,5,7-trihydroxy-6,8-dimethyl-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | CC1=C(C(=C2C(=C1O)C(=O)C(C(O2)O)CC3=CC4=C(C=C3)OCO4)C)O |
| SMILES (Isomeric) | CC1=C(C(=C2C(=C1O)C(=O)C(C(O2)O)CC3=CC4=C(C=C3)OCO4)C)O |
| InChI | InChI=1S/C19H18O7/c1-8-15(20)9(2)18-14(16(8)21)17(22)11(19(23)26-18)5-10-3-4-12-13(6-10)25-7-24-12/h3-4,6,11,19-21,23H,5,7H2,1-2H3 |
| InChI Key | HUGFWFLIFYXRSJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.10525291 g/mol |
| Topological Polar Surface Area (TPSA) | 105.00 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.69% | 94.45% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.65% | 96.77% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.26% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.08% | 98.95% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 94.74% | 94.80% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.72% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.66% | 89.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.18% | 92.62% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.09% | 93.40% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.45% | 94.73% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.97% | 95.89% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.53% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.99% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.70% | 94.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.58% | 96.95% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.69% | 90.71% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.31% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ophiopogon japonicus |
| PubChem | 5322062 |
| LOTUS | LTS0028435 |
| wikiData | Q105033760 |