3-(1,3-Benzodioxol-5-yl)-1-(4-methoxy-1-benzofuran-5-yl)propan-1-one
Internal ID | de67732e-4f6c-46c9-9d3e-234973158a5c |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Butyrophenones |
IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-(4-methoxy-1-benzofuran-5-yl)propan-1-one |
SMILES (Canonical) | COC1=C(C=CC2=C1C=CO2)C(=O)CCC3=CC4=C(C=C3)OCO4 |
SMILES (Isomeric) | COC1=C(C=CC2=C1C=CO2)C(=O)CCC3=CC4=C(C=C3)OCO4 |
InChI | InChI=1S/C19H16O5/c1-21-19-13(4-7-16-14(19)8-9-22-16)15(20)5-2-12-3-6-17-18(10-12)24-11-23-17/h3-4,6-10H,2,5,11H2,1H3 |
InChI Key | VZQKDAAIVCVSSU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H16O5 |
Molecular Weight | 324.30 g/mol |
Exact Mass | 324.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 57.90 Ų |
XlogP | 3.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 99.08% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.75% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.80% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.38% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.30% | 98.95% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 94.95% | 94.80% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.65% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.26% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.55% | 92.62% |
CHEMBL2535 | P11166 | Glucose transporter | 90.47% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.62% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.75% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.39% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.95% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.65% | 96.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.27% | 95.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.95% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lonchocarpus subglaucescens |
PubChem | 101995341 |
LOTUS | LTS0054601 |
wikiData | Q105299931 |