3-[13-(1,3-Benzodioxol-5-yl)tridecyl]-4-hydroxy-5-methylidenefuran-2-one
Internal ID | 9dd5c4bc-494f-46ee-a636-2874558ae2c7 |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | 3-[13-(1,3-benzodioxol-5-yl)tridecyl]-4-hydroxy-5-methylidenefuran-2-one |
SMILES (Canonical) | C=C1C(=C(C(=O)O1)CCCCCCCCCCCCCC2=CC3=C(C=C2)OCO3)O |
SMILES (Isomeric) | C=C1C(=C(C(=O)O1)CCCCCCCCCCCCCC2=CC3=C(C=C2)OCO3)O |
InChI | InChI=1S/C25H34O5/c1-19-24(26)21(25(27)30-19)14-12-10-8-6-4-2-3-5-7-9-11-13-20-15-16-22-23(17-20)29-18-28-22/h15-17,26H,1-14,18H2 |
InChI Key | CRCRYZRLFQWUDJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H34O5 |
Molecular Weight | 414.50 g/mol |
Exact Mass | 414.24062418 g/mol |
Topological Polar Surface Area (TPSA) | 65.00 Ų |
XlogP | 8.20 |
There are no found synonyms. |
![2D Structure of 3-[13-(1,3-Benzodioxol-5-yl)tridecyl]-4-hydroxy-5-methylidenefuran-2-one 2D Structure of 3-[13-(1,3-Benzodioxol-5-yl)tridecyl]-4-hydroxy-5-methylidenefuran-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/3-13-13-benzodioxol-5-yltridecyl-4-hydroxy-5-methylidenefuran-2-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.99% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.53% | 98.95% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.90% | 94.80% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.95% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.31% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.10% | 86.33% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.49% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.98% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.40% | 94.73% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.34% | 95.17% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.86% | 83.57% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 87.61% | 96.25% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.76% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.09% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.13% | 89.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.94% | 93.40% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 82.42% | 96.37% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.62% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Iryanthera elliptica |
PubChem | 162860372 |
LOTUS | LTS0195230 |
wikiData | Q104968462 |