3-(10,11-Dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-4,6-dihydroxy-2-methylbenzoic acid
| Internal ID | 3d43959c-964e-4062-8c96-d7c2f483a0a4 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 3-(10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-4,6-dihydroxy-2-methylbenzoic acid |
| SMILES (Canonical) | CC1=C(C(=CC(=C1C(=O)O)O)O)CC=C(C)CCC=C(C)CCC(C(C)(C)O)O |
| SMILES (Isomeric) | CC1=C(C(=CC(=C1C(=O)O)O)O)CC=C(C)CCC=C(C)CCC(C(C)(C)O)O |
| InChI | InChI=1S/C23H34O6/c1-14(7-6-8-15(2)10-12-20(26)23(4,5)29)9-11-17-16(3)21(22(27)28)19(25)13-18(17)24/h8-9,13,20,24-26,29H,6-7,10-12H2,1-5H3,(H,27,28) |
| InChI Key | PLQYDIDGVVEJIJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.23553880 g/mol |
| Topological Polar Surface Area (TPSA) | 118.00 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.97% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 96.42% | 94.73% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 95.68% | 97.21% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.35% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.27% | 99.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.31% | 93.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.89% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.66% | 99.15% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.45% | 92.08% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.25% | 96.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.72% | 96.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.36% | 96.90% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.21% | 90.71% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 82.11% | 92.51% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.69% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.20% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.95% | 96.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.07% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163063628 |
| LOTUS | LTS0235654 |
| wikiData | Q105211154 |