[(2Z,9E,11R)-11-hydroxyheptadeca-2,9,16-trien-4,6-diynyl] acetate
| Internal ID | 94fffac1-9486-4fd1-a55b-ee3bbf10cc80 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohol esters |
| IUPAC Name | [(2Z,9E,11R)-11-hydroxyheptadeca-2,9,16-trien-4,6-diynyl] acetate |
| SMILES (Canonical) | CC(=O)OCC=CC#CC#CCC=CC(CCCCC=C)O |
| SMILES (Isomeric) | CC(=O)OC/C=C\C#CC#CC/C=C/[C@@H](CCCCC=C)O |
| InChI | InChI=1S/C19H24O3/c1-3-4-5-12-15-19(21)16-13-10-8-6-7-9-11-14-17-22-18(2)20/h3,11,13-14,16,19,21H,1,4-5,10,12,15,17H2,2H3/b14-11-,16-13+/t19-/m1/s1 |
| InChI Key | ZTWKZIUIWNKUJP-DIJMCWENSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17254462 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
![2D Structure of [(2Z,9E,11R)-11-hydroxyheptadeca-2,9,16-trien-4,6-diynyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/2z9e11r-11-hydroxyheptadeca-2916-trien-46-diynyl-acetate.jpg "2D Structure of [(2Z,9E,11R)-11-hydroxyheptadeca-2,9,16-trien-4,6-diynyl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.80% | 96.09% |
| CHEMBL240 | Q12809 | HERG | 96.27% | 89.76% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.34% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.52% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.00% | 98.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.43% | 96.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.68% | 91.49% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 84.10% | 97.47% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.78% | 91.19% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.34% | 94.73% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.29% | 90.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.22% | 96.47% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.57% | 85.14% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.53% | 98.75% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.47% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Solidago spathulata |
| PubChem | 163030873 |
| LOTUS | LTS0135078 |
| wikiData | Q105383298 |