(2Z,6Z,10Z,14E,19R,23R)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14-tetraen-1-ol
| Internal ID | 9b6dbba3-04fd-407d-8881-419717c92389 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesterterpenoids |
| IUPAC Name | (2Z,6Z,10Z,14E,19R,23R)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14-tetraen-1-ol |
| SMILES (Canonical) | CC(C)CCCC(C)CCCC(C)CCCC(=CCCC(=CCCC(=CCCC(=CCO)C)C)C)C |
| SMILES (Isomeric) | C[C@@H](CCC[C@@H](C)CCC/C(=C/CC/C(=C\CC/C(=C\CC/C(=C\CO)/C)/C)/C)/C)CCCC(C)C |
| InChI | InChI=1S/C35H64O/c1-29(2)15-9-16-30(3)17-10-18-31(4)19-11-20-32(5)21-12-22-33(6)23-13-24-34(7)25-14-26-35(8)27-28-36/h21,23,25,27,29-31,36H,9-20,22,24,26,28H2,1-8H3/b32-21+,33-23-,34-25-,35-27-/t30-,31-/m1/s1 |
| InChI Key | LDYCRGBGOFWPTL-RIYPJUEFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H64O |
| Molecular Weight | 500.90 g/mol |
| Exact Mass | 500.495716661 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 13.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.02% | 97.29% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.90% | 98.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.54% | 93.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.39% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.33% | 99.17% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 85.76% | 93.31% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.32% | 91.11% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.44% | 92.08% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 83.18% | 92.51% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.97% | 94.73% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 81.82% | 87.45% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.99% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arachis hypogaea |
| PubChem | 101939146 |
| LOTUS | LTS0214637 |
| wikiData | Q105150442 |