(2S,5S)-2-butyl-5-propylpyrrolidine
| Internal ID | 26947388-6c30-4028-8c9c-b304e2f5e987 |
| Taxonomy | Organoheterocyclic compounds > Pyrrolidines |
| IUPAC Name | (2S,5S)-2-butyl-5-propylpyrrolidine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H23N/c1-3-5-7-11-9-8-10(12-11)6-4-2/h10-12H,3-9H2,1-2H3/t10-,11-/m0/s1 |
| InChI Key | ZYYRGIIKYRSMCS-QWRGUYRKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.183049738 g/mol |
| Topological Polar Surface Area (TPSA) | 12.00 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.03% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.67% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.99% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.77% | 97.09% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 91.59% | 94.55% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 90.50% | 97.79% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.56% | 92.86% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.02% | 94.45% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.21% | 97.29% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.75% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.55% | 95.93% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 83.52% | 97.64% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.38% | 99.18% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.19% | 96.95% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 82.93% | 90.24% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 82.75% | 98.03% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 81.14% | 91.81% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 81.09% | 98.59% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.01% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16109755 |
| LOTUS | LTS0200651 |
| wikiData | Q105386569 |