(2S,4S)-2-amino-5-benzamido-4-hydroxypentanoic acid
| Internal ID | e8d990aa-250c-4dc5-b639-ccb0a3d6cc62 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acids > L-alpha-amino acids |
| IUPAC Name | (2S,4S)-2-amino-5-benzamido-4-hydroxypentanoic acid |
| SMILES (Canonical) | C1=CC=C(C=C1)C(=O)NCC(CC(C(=O)O)N)O |
| SMILES (Isomeric) | C1=CC=C(C=C1)C(=O)NC[C@H](C[C@@H](C(=O)O)N)O |
| InChI | InChI=1S/C12H16N2O4/c13-10(12(17)18)6-9(15)7-14-11(16)8-4-2-1-3-5-8/h1-5,9-10,15H,6-7,13H2,(H,14,16)(H,17,18)/t9-,10-/m0/s1 |
| InChI Key | UEFUDKNGNDHCRI-UWVGGRQHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11100700 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | -2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.88% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.48% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.81% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.28% | 95.56% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 89.23% | 87.67% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.59% | 91.11% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.28% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 87.89% | 90.20% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 85.45% | 81.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.76% | 99.17% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 84.23% | 96.67% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 82.04% | 89.33% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 81.04% | 81.58% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vicia pseudo-orobus |
| PubChem | 163020499 |
| LOTUS | LTS0224602 |
| wikiData | Q105270873 |