(2S,3R,4S,5S,6R)-2-(4,8-dihydroxy-3-methylnaphthalen-1-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 16fe763c-c3ca-463f-8277-bd6b4d1137ca |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | (2S,3R,4S,5S,6R)-2-(4,8-dihydroxy-3-methylnaphthalen-1-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1=CC(=C2C(=C1O)C=CC=C2O)OC3C(C(C(C(O3)CO)O)O)O |
SMILES (Isomeric) | CC1=CC(=C2C(=C1O)C=CC=C2O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
InChI | InChI=1S/C17H20O8/c1-7-5-10(12-8(13(7)20)3-2-4-9(12)19)24-17-16(23)15(22)14(21)11(6-18)25-17/h2-5,11,14-23H,6H2,1H3/t11-,14-,15+,16-,17-/m1/s1 |
InChI Key | MRLGZVFLBTWJSX-ZQOQDGPXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H20O8 |
Molecular Weight | 352.30 g/mol |
Exact Mass | 352.11581759 g/mol |
Topological Polar Surface Area (TPSA) | 140.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.95% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.22% | 94.73% |
CHEMBL220 | P22303 | Acetylcholinesterase | 93.35% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.01% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.61% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.54% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.34% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.29% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.72% | 99.15% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.04% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.57% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.33% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.83% | 96.00% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 85.51% | 83.57% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.13% | 99.17% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.22% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ceratostigma minus |
Dionaea muscipula |
Drosera intermedia |
Drosophyllum lusitanicum |
Nepenthes insignis |
PubChem | 14482771 |
LOTUS | LTS0198978 |
wikiData | Q105170673 |