[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl] 1H-indole-3-carboxylate
| Internal ID | 3d724fd6-b49c-4058-8f97-32677084b57c |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolecarboxylic acids and derivatives |
| IUPAC Name | [(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl] 1H-indole-3-carboxylate |
| SMILES (Canonical) | C1C(C(C(C(O1)OC(=O)C2=CNC3=CC=CC=C32)O)O)O |
| SMILES (Isomeric) | C1[C@@H]([C@H]([C@H]([C@@H](O1)OC(=O)C2=CNC3=CC=CC=C32)O)O)O |
| InChI | InChI=1S/C14H15NO6/c16-10-6-20-14(12(18)11(10)17)21-13(19)8-5-15-9-4-2-1-3-7(8)9/h1-5,10-12,14-18H,6H2/t10-,11+,12+,14-/m0/s1 |
| InChI Key | VANLGDRDLRCFJZ-SFTQSGBHSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.08993720 g/mol |
| Topological Polar Surface Area (TPSA) | 112.00 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.36% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.67% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.07% | 95.56% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 90.97% | 92.67% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.74% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.70% | 98.75% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.10% | 83.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.31% | 97.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.61% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.19% | 89.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.94% | 95.56% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 84.14% | 88.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.89% | 92.62% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.61% | 99.23% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 83.12% | 85.83% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.73% | 93.03% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.28% | 83.10% |
| CHEMBL5028 | O14672 | ADAM10 | 81.10% | 97.50% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.95% | 94.62% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 80.23% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163114250 |
| LOTUS | LTS0083938 |
| wikiData | Q105282864 |